C13H12F3NO2 — CID 4527747
ethyl 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoate (PubChem CID 4527747) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 4527747 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)C(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2/c1-2-19-12(18)11(13(14,15)16)9-7-17-10-6-4-3-5-8(9)10/h3-7,11,17H,2H2,1H3 |
| InChIKey | DDAGREBAARLNKZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |