C14H15NO3 — CID 75252498
ethyl 2-(1H-indol-3-yl)-4-oxobutanoate (PubChem CID 75252498) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-(1H-indol-3-yl)-4-oxobutanoate.
| Compound Name | ethyl 2-(1H-indol-3-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 75252498 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | ethyl 2-(1H-indol-3-yl)-4-oxobutanoate |
| SMILES | CCOC(=O)C(CC=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H15NO3/c1-2-18-14(17)11(7-8-16)12-9-15-13-6-4-3-5-10(12)13/h3-6,8-9,11,15H,2,7H2,1H3 |
| InChIKey | UFBHDUFBQNHVCY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|