C14H18N2O — CID 166107005
2-(1H-indol-3-yl)-N,N-dimethylbutanamide (PubChem CID 166107005) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-dimethylbutanamide.
| Compound Name | 2-(1H-indol-3-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 166107005 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-dimethylbutanamide |
| SMILES | CCC(C(=O)N(C)C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H18N2O/c1-4-10(14(17)16(2)3)12-9-15-13-8-6-5-7-11(12)13/h5-10,15H,4H2,1-3H3 |
| InChIKey | MXWBSLKGAJYKMW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |