C22H23F3N2O2 — CID 19796650
ethyl 2-[ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-(1H-indol-3-yl)acetate (PubChem CID 19796650) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is ethyl 2-[ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-(1H-indol-3-yl)acetate.
| Compound Name | ethyl 2-[ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 19796650 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl 2-[ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-(1H-indol-3-yl)acetate |
| SMILES | CCOC(=O)C(c1c[nH]c2ccccc12)N(CC)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N2O2/c1-3-27(14-15-8-7-9-16(12-15)22(23,24)25)20(21(28)29-4-2)18-13-26-19-11-6-5-10-17(18)19/h5-13,20,26H,3-4,14H2,1-2H3 |
| InChIKey | IYZHSOADVIWMDM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |