C24H30F3N2O3P — CID 7059877
N-[(S)-dibutoxyphosphoryl(1H-indol-3-yl)methyl]-3-(trifluoromethyl)aniline (PubChem CID 7059877) has the molecular formula C24H30F3N2O3P and a molecular weight of 482.48 g/mol. Its IUPAC name is N-[(S)-dibutoxyphosphoryl(1H-indol-3-yl)methyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(S)-dibutoxyphosphoryl(1H-indol-3-yl)methyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 7059877 |
| Molecular Formula | C24H30F3N2O3P |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[(S)-dibutoxyphosphoryl(1H-indol-3-yl)methyl]-3-(trifluoromethyl)aniline |
| SMILES | CCCCOP(=O)(OCCCC)[C@H](Nc1cccc(C(F)(F)F)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H30F3N2O3P/c1-3-5-14-31-33(30,32-15-6-4-2)23(21-17-28-22-13-8-7-12-20(21)22)29-19-11-9-10-18(16-19)24(25,26)27/h7-13,16-17,23,28-29H,3-6,14-15H2,1-2H3/t23-/m0/s1 |
| InChIKey | NLFDNRVXHTYHDB-QHCPKHFHSA-N |
| XLogP | 8.12 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|