C21H26N3O5P — CID 92651230
N-[(S)-dipropoxyphosphoryl(1H-indol-3-yl)methyl]-4-nitroaniline (PubChem CID 92651230) has the molecular formula C21H26N3O5P and a molecular weight of 431.43 g/mol. Its IUPAC name is N-[(S)-dipropoxyphosphoryl(1H-indol-3-yl)methyl]-4-nitroaniline.
| Compound Name | N-[(S)-dipropoxyphosphoryl(1H-indol-3-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 92651230 |
| Molecular Formula | C21H26N3O5P |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[(S)-dipropoxyphosphoryl(1H-indol-3-yl)methyl]-4-nitroaniline |
| SMILES | CCCOP(=O)(OCCC)[C@H](Nc1ccc([N+](=O)[O-])cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H26N3O5P/c1-3-13-28-30(27,29-14-4-2)21(19-15-22-20-8-6-5-7-18(19)20)23-16-9-11-17(12-10-16)24(25)26/h5-12,15,21-23H,3-4,13-14H2,1-2H3/t21-/m0/s1 |
| InChIKey | SWKGUIJHMBXMIC-NRFANRHFSA-N |
| XLogP | 6.23 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|