C22H30N3O5P — CID 53492936
N-[diethoxyphosphoryl-(4-piperidin-1-ylphenyl)methyl]-4-nitroaniline (PubChem CID 53492936) has the molecular formula C22H30N3O5P and a molecular weight of 447.47 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(4-piperidin-1-ylphenyl)methyl]-4-nitroaniline.
| Compound Name | N-[diethoxyphosphoryl-(4-piperidin-1-ylphenyl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 53492936 |
| Molecular Formula | C22H30N3O5P |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[diethoxyphosphoryl-(4-piperidin-1-ylphenyl)methyl]-4-nitroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc([N+](=O)[O-])cc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H30N3O5P/c1-3-29-31(28,30-4-2)22(23-19-10-14-21(15-11-19)25(26)27)18-8-12-20(13-9-18)24-16-6-5-7-17-24/h8-15,22-23H,3-7,16-17H2,1-2H3 |
| InChIKey | JMLKDTHCYRQNAA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|