C22H31N2O5P — CID 40783189
N-[(R)-dipropoxyphosphoryl-(4-nitrophenyl)methyl]-4-propan-2-ylaniline (PubChem CID 40783189) has the molecular formula C22H31N2O5P and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[(R)-dipropoxyphosphoryl-(4-nitrophenyl)methyl]-4-propan-2-ylaniline.
| Compound Name | N-[(R)-dipropoxyphosphoryl-(4-nitrophenyl)methyl]-4-propan-2-ylaniline |
|---|---|
| PubChem CID | 40783189 |
| Molecular Formula | C22H31N2O5P |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[(R)-dipropoxyphosphoryl-(4-nitrophenyl)methyl]-4-propan-2-ylaniline |
| SMILES | CCCOP(=O)(OCCC)[C@@H](Nc1ccc(C(C)C)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H31N2O5P/c1-5-15-28-30(27,29-16-6-2)22(19-9-13-21(14-10-19)24(25)26)23-20-11-7-18(8-12-20)17(3)4/h7-14,17,22-23H,5-6,15-16H2,1-4H3/t22-/m1/s1 |
| InChIKey | GZEFIKYFYQREPS-JOCHJYFZSA-N |
| XLogP | 6.88 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|