C17H22BN2O7P — CID 139062430
[4-[(R)-diethoxyphosphoryl-(4-nitroanilino)methyl]phenyl]boronic acid (PubChem CID 139062430) has the molecular formula C17H22BN2O7P and a molecular weight of 408.16 g/mol. Its IUPAC name is [4-[(R)-diethoxyphosphoryl-(4-nitroanilino)methyl]phenyl]boronic acid.
| Compound Name | [4-[(R)-diethoxyphosphoryl-(4-nitroanilino)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 139062430 |
| Molecular Formula | C17H22BN2O7P |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [4-[(R)-diethoxyphosphoryl-(4-nitroanilino)methyl]phenyl]boronic acid |
| SMILES | CCOP(=O)(OCC)[C@@H](Nc1ccc([N+](=O)[O-])cc1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C17H22BN2O7P/c1-3-26-28(25,27-4-2)17(13-5-7-14(8-6-13)18(21)22)19-15-9-11-16(12-10-15)20(23)24/h5-12,17,19,21-22H,3-4H2,1-2H3/t17-/m1/s1 |
| InChIKey | ZIAOQDNLCVNKLY-QGZVFWFLSA-N |
| XLogP | 2.65 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|