C15H27BNO5P — CID 139062429
[4-[(R)-butylamino(diethoxyphosphoryl)methyl]phenyl]boronic acid (PubChem CID 139062429) has the molecular formula C15H27BNO5P and a molecular weight of 343.17 g/mol. Its IUPAC name is [4-[(R)-butylamino(diethoxyphosphoryl)methyl]phenyl]boronic acid.
| Compound Name | [4-[(R)-butylamino(diethoxyphosphoryl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 139062429 |
| Molecular Formula | C15H27BNO5P |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | [4-[(R)-butylamino(diethoxyphosphoryl)methyl]phenyl]boronic acid |
| SMILES | CCCCN[C@@H](c1ccc(B(O)O)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H27BNO5P/c1-4-7-12-17-15(23(20,21-5-2)22-6-3)13-8-10-14(11-9-13)16(18)19/h8-11,15,17-19H,4-7,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | CGCICFLJXCDIMQ-OAHLLOKOSA-N |
| XLogP | 2.02 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|