C17H28NO5P — CID 101090705
tert-butyl N-[(R)-diethoxyphosphoryl-(4-methylphenyl)methyl]carbamate (PubChem CID 101090705) has the molecular formula C17H28NO5P and a molecular weight of 357.39 g/mol. Its IUPAC name is tert-butyl N-[(R)-diethoxyphosphoryl-(4-methylphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-diethoxyphosphoryl-(4-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 101090705 |
| Molecular Formula | C17H28NO5P |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl N-[(R)-diethoxyphosphoryl-(4-methylphenyl)methyl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@@H](NC(=O)OC(C)(C)C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28NO5P/c1-7-21-24(20,22-8-2)15(14-11-9-13(3)10-12-14)18-16(19)23-17(4,5)6/h9-12,15H,7-8H2,1-6H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | NRBNGIHBIBSKKY-OAHLLOKOSA-N |
| XLogP | 4.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|