C19H29N3O5 — CID 100651422
tert-butyl N-[[(2S)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]carbamate (PubChem CID 100651422) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 100651422 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl N-[[(2S)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]carbamate |
| SMILES | Cc1ccc([C@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O5/c1-12-8-10-13(11-9-12)14(20-16(24)26-18(2,3)4)15(23)21-22-17(25)27-19(5,6)7/h8-11,14H,1-7H3,(H,20,24)(H,21,23)(H,22,25)/t14-/m0/s1 |
| InChIKey | JAOBMMPAGHKYCE-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|