C16H31N2O7P — CID 101219920
tert-butyl N-[(2R)-1-[(1-diethoxyphosphoryl-2-oxobutyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 101219920) has the molecular formula C16H31N2O7P and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(1-diethoxyphosphoryl-2-oxobutyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(1-diethoxyphosphoryl-2-oxobutyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101219920 |
| Molecular Formula | C16H31N2O7P |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(1-diethoxyphosphoryl-2-oxobutyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)C(NC(=O)[C@@H](C)NC(=O)OC(C)(C)C)C(=O)CC |
| InChI | InChI=1S/C16H31N2O7P/c1-8-12(19)14(26(22,23-9-2)24-10-3)18-13(20)11(4)17-15(21)25-16(5,6)7/h11,14H,8-10H2,1-7H3,(H,17,21)(H,18,20)/t11-,14?/m1/s1 |
| InChIKey | OSTLPOXDLSCPCP-YNODCEANSA-N |
| XLogP | 2.59 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|