C20H31FNO7P — CID 11155076
dimethyl 2-[1-[[diethoxyphosphoryl-(4-fluorophenyl)methyl]amino]-2-methylpropan-2-yl]propanedioate (PubChem CID 11155076) has the molecular formula C20H31FNO7P and a molecular weight of 447.44 g/mol. Its IUPAC name is dimethyl 2-[1-[[diethoxyphosphoryl-(4-fluorophenyl)methyl]amino]-2-methylpropan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[1-[[diethoxyphosphoryl-(4-fluorophenyl)methyl]amino]-2-methylpropan-2-yl]propanedioate |
|---|---|
| PubChem CID | 11155076 |
| Molecular Formula | C20H31FNO7P |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | dimethyl 2-[1-[[diethoxyphosphoryl-(4-fluorophenyl)methyl]amino]-2-methylpropan-2-yl]propanedioate |
| SMILES | CCOP(=O)(OCC)C(NCC(C)(C)C(C(=O)OC)C(=O)OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H31FNO7P/c1-7-28-30(25,29-8-2)17(14-9-11-15(21)12-10-14)22-13-20(3,4)16(18(23)26-5)19(24)27-6/h9-12,16-17,22H,7-8,13H2,1-6H3 |
| InChIKey | YDOLQEITKWBNBJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|