C19H26N3O5P — CID 21210794
4-[diethoxyphosphoryl-(4-nitroanilino)methyl]-N,N-dimethylaniline (PubChem CID 21210794) has the molecular formula C19H26N3O5P and a molecular weight of 407.41 g/mol. Its IUPAC name is 4-[diethoxyphosphoryl-(4-nitroanilino)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[diethoxyphosphoryl-(4-nitroanilino)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 21210794 |
| Molecular Formula | C19H26N3O5P |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[diethoxyphosphoryl-(4-nitroanilino)methyl]-N,N-dimethylaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc([N+](=O)[O-])cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H26N3O5P/c1-5-26-28(25,27-6-2)19(15-7-11-17(12-8-15)21(3)4)20-16-9-13-18(14-10-16)22(23)24/h7-14,19-20H,5-6H2,1-4H3 |
| InChIKey | BPXWXTFWTJXBKL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|