C19H26ClN2O3P — CID 21210791
3-chloro-N-[diethoxyphosphoryl-[4-(dimethylamino)phenyl]methyl]aniline (PubChem CID 21210791) has the molecular formula C19H26ClN2O3P and a molecular weight of 396.86 g/mol. Its IUPAC name is 3-chloro-N-[diethoxyphosphoryl-[4-(dimethylamino)phenyl]methyl]aniline.
| Compound Name | 3-chloro-N-[diethoxyphosphoryl-[4-(dimethylamino)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 21210791 |
| Molecular Formula | C19H26ClN2O3P |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-chloro-N-[diethoxyphosphoryl-[4-(dimethylamino)phenyl]methyl]aniline |
| SMILES | CCOP(=O)(OCC)C(Nc1cccc(Cl)c1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H26ClN2O3P/c1-5-24-26(23,25-6-2)19(21-17-9-7-8-16(20)14-17)15-10-12-18(13-11-15)22(3)4/h7-14,19,21H,5-6H2,1-4H3 |
| InChIKey | HHIINGBEDDTOCW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|