C20H28ClN2O5P — CID 139086862
4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide (PubChem CID 139086862) has the molecular formula C20H28ClN2O5P and a molecular weight of 442.88 g/mol. Its IUPAC name is 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide.
| Compound Name | 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide |
|---|---|
| PubChem CID | 139086862 |
| Molecular Formula | C20H28ClN2O5P |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide |
| SMILES | CCOP(=O)(OCC)[C@@H](Nc1ccc(Cl)cc1)c1ccc(O)cc1.CN(C)C=O |
| InChI | InChI=1S/C17H21ClNO4P.C3H7NO/c1-3-22-24(21,23-4-2)17(13-5-11-16(20)12-6-13)19-15-9-7-14(18)8-10-15;1-4(2)3-5/h5-12,17,19-20H,3-4H2,1-2H3;3H,1-2H3/t17-;/m1./s1 |
| InChIKey | WJHWYJFNLZMOIR-UNTBIKODSA-N |
| XLogP | 5.13 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|