About 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide
4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide (PubChem CID 139086862) has the molecular formula C20H28ClN2O5P
and a molecular weight of 442.88 g/mol. Its IUPAC name is 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide.
Molecular Properties
| Compound Name | 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide |
| PubChem CID | 139086862 |
| Molecular Formula | C20H28ClN2O5P |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide |
| SMILES | CCOP(=O)(OCC)[C@@H](Nc1ccc(Cl)cc1)c1ccc(O)cc1.CN(C)C=O |
| InChI | InChI=1S/C17H21ClNO4P.C3H7NO/c1-3-22-24(21,23-4-2)17(13-5-11-16(20)12-6-13)19-15-9-7-14(18)8-10-15;1-4(2)3-5/h5-12,17,19-20H,3-4H2,1-2H3;3H,1-2H3/t17-;/m1./s1 |
| InChIKey | WJHWYJFNLZMOIR-UNTBIKODSA-N |
| XLogP | 5.13 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide?
The IUPAC name of 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide (CID 139086862) is 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide.
What is the SMILES notation for 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide?
The canonical SMILES for 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide is CCOP(=O)(OCC)[C@@H](Nc1ccc(Cl)cc1)c1ccc(O)cc1.CN(C)C=O.
What is the InChIKey of 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide?
The InChIKey is WJHWYJFNLZMOIR-UNTBIKODSA-N. The full InChI is InChI=1S/C17H21ClNO4P.C3H7NO/c1-3-22-24(21,23-4-2)17(13-5-11-16(20)12-6-13)19-15-9-7-14(18)8-10-15;1-4(2)3-5/h5-12,17,19-20H,3-4H2,1-2H3;3H,1-2H3/t17-;/m1./s1.
What are the key properties of 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide?
4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide has a molecular weight of 442.88 g/mol, XLogP of 5.13, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-(4-chloroanilino)-diethoxyphosphorylmethyl]phenol;N,N-dimethylformamide is sourced from PubChem (CID 139086862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).