C19H24BrClNO3P — CID 4299844
N-[(4-bromophenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-chloroaniline (PubChem CID 4299844) has the molecular formula C19H24BrClNO3P and a molecular weight of 460.74 g/mol. Its IUPAC name is N-[(4-bromophenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-chloroaniline.
| Compound Name | N-[(4-bromophenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-chloroaniline |
|---|---|
| PubChem CID | 4299844 |
| Molecular Formula | C19H24BrClNO3P |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[(4-bromophenyl)-di(propan-2-yloxy)phosphorylmethyl]-4-chloroaniline |
| SMILES | CC(C)OP(=O)(OC(C)C)C(Nc1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrClNO3P/c1-13(2)24-26(23,25-14(3)4)19(15-5-7-16(20)8-6-15)22-18-11-9-17(21)10-12-18/h5-14,19,22H,1-4H3 |
| InChIKey | ZZNOIZLXXAYOSI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|