C21H31N2O3P — CID 3450279
4-[anilino-di(propan-2-yloxy)phosphorylmethyl]-N,N-dimethylaniline (PubChem CID 3450279) has the molecular formula C21H31N2O3P and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-[anilino-di(propan-2-yloxy)phosphorylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[anilino-di(propan-2-yloxy)phosphorylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3450279 |
| Molecular Formula | C21H31N2O3P |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 4-[anilino-di(propan-2-yloxy)phosphorylmethyl]-N,N-dimethylaniline |
| SMILES | CC(C)OP(=O)(OC(C)C)C(Nc1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H31N2O3P/c1-16(2)25-27(24,26-17(3)4)21(22-19-10-8-7-9-11-19)18-12-14-20(15-13-18)23(5)6/h7-17,21-22H,1-6H3 |
| InChIKey | FWKQFUAYVYDKQU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|