C23H26ClN2O2P — CID 41078696
4-[[(R)-anilino-(4-chlorophenyl)methyl]-ethoxyphosphoryl]-N,N-dimethylaniline (PubChem CID 41078696) has the molecular formula C23H26ClN2O2P and a molecular weight of 428.90 g/mol. Its IUPAC name is 4-[[(R)-anilino-(4-chlorophenyl)methyl]-ethoxyphosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(R)-anilino-(4-chlorophenyl)methyl]-ethoxyphosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 41078696 |
| Molecular Formula | C23H26ClN2O2P |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-[[(R)-anilino-(4-chlorophenyl)methyl]-ethoxyphosphoryl]-N,N-dimethylaniline |
| SMILES | CCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN2O2P/c1-4-28-29(27,22-16-14-21(15-17-22)26(2)3)23(18-10-12-19(24)13-11-18)25-20-8-6-5-7-9-20/h5-17,23,25H,4H2,1-3H3/t23-,29+/m1/s1 |
| InChIKey | KKLHEYRTIBRJLH-BTYSJIOQSA-N |
| XLogP | 6.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|