C21H17F5NO2P — CID 5112991
N-[[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-phenylmethyl]aniline (PubChem CID 5112991) has the molecular formula C21H17F5NO2P and a molecular weight of 441.34 g/mol. Its IUPAC name is N-[[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-phenylmethyl]aniline.
| Compound Name | N-[[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-phenylmethyl]aniline |
|---|---|
| PubChem CID | 5112991 |
| Molecular Formula | C21H17F5NO2P |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[[ethoxy-(2,3,4,5,6-pentafluorophenyl)phosphoryl]-phenylmethyl]aniline |
| SMILES | CCOP(=O)(c1c(F)c(F)c(F)c(F)c1F)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17F5NO2P/c1-2-29-30(28,20-18(25)16(23)15(22)17(24)19(20)26)21(13-9-5-3-6-10-13)27-14-11-7-4-8-12-14/h3-12,21,27H,2H2,1H3 |
| InChIKey | SOJKJWFQCFBEPQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|