C18H21F3NO4P — CID 10250571
N-[diethoxyphosphoryl(phenyl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 10250571) has the molecular formula C18H21F3NO4P and a molecular weight of 403.34 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(phenyl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[diethoxyphosphoryl(phenyl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 10250571 |
| Molecular Formula | C18H21F3NO4P |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[diethoxyphosphoryl(phenyl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(OC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21F3NO4P/c1-3-24-27(23,25-4-2)17(14-8-6-5-7-9-14)22-15-10-12-16(13-11-15)26-18(19,20)21/h5-13,17,22H,3-4H2,1-2H3 |
| InChIKey | JYNXKWJMYVVUAB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|