C14H21F3NO3P — CID 15184968
N-(3-diethoxyphosphoryl-1,1,1-trifluorobutan-2-yl)aniline (PubChem CID 15184968) has the molecular formula C14H21F3NO3P and a molecular weight of 339.29 g/mol. Its IUPAC name is N-(3-diethoxyphosphoryl-1,1,1-trifluorobutan-2-yl)aniline.
| Compound Name | N-(3-diethoxyphosphoryl-1,1,1-trifluorobutan-2-yl)aniline |
|---|---|
| PubChem CID | 15184968 |
| Molecular Formula | C14H21F3NO3P |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(3-diethoxyphosphoryl-1,1,1-trifluorobutan-2-yl)aniline |
| SMILES | CCOP(=O)(OCC)C(C)C(Nc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H21F3NO3P/c1-4-20-22(19,21-5-2)11(3)13(14(15,16)17)18-12-9-7-6-8-10-12/h6-11,13,18H,4-5H2,1-3H3 |
| InChIKey | RVXUAKZKTMKYBR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|