C16H25F3NO3P — CID 15184969
3-diethoxyphosphoryl-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine (PubChem CID 15184969) has the molecular formula C16H25F3NO3P and a molecular weight of 367.35 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine.
| Compound Name | 3-diethoxyphosphoryl-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine |
|---|---|
| PubChem CID | 15184969 |
| Molecular Formula | C16H25F3NO3P |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-diethoxyphosphoryl-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine |
| SMILES | CCOP(=O)(OCC)C(C)C(NCCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H25F3NO3P/c1-4-22-24(21,23-5-2)13(3)15(16(17,18)19)20-12-11-14-9-7-6-8-10-14/h6-10,13,15,20H,4-5,11-12H2,1-3H3 |
| InChIKey | FTUBQLFYOAOVKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|