C12H15ClF3N — CID 121001406
4-chloro-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine (PubChem CID 121001406) has the molecular formula C12H15ClF3N and a molecular weight of 265.71 g/mol. Its IUPAC name is 4-chloro-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine.
| Compound Name | 4-chloro-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine |
|---|---|
| PubChem CID | 121001406 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-chloro-1,1,1-trifluoro-N-(2-phenylethyl)butan-2-amine |
| SMILES | FC(F)(F)C(CCCl)NCCc1ccccc1 |
| InChI | InChI=1S/C12H15ClF3N/c13-8-6-11(12(14,15)16)17-9-7-10-4-2-1-3-5-10/h1-5,11,17H,6-9H2 |
| InChIKey | ZCULTFBCEMEFDF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|