C13H17BrF3N — CID 102289022
4-bromo-1,1,1-trifluoro-N-[2-(4-methylphenyl)ethyl]butan-2-amine (PubChem CID 102289022) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is 4-bromo-1,1,1-trifluoro-N-[2-(4-methylphenyl)ethyl]butan-2-amine.
| Compound Name | 4-bromo-1,1,1-trifluoro-N-[2-(4-methylphenyl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 102289022 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-bromo-1,1,1-trifluoro-N-[2-(4-methylphenyl)ethyl]butan-2-amine |
| SMILES | Cc1ccc(CCNC(CCBr)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17BrF3N/c1-10-2-4-11(5-3-10)7-9-18-12(6-8-14)13(15,16)17/h2-5,12,18H,6-9H2,1H3 |
| InChIKey | PYSISKGQIWVBCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|