C18H20F3NO — CID 10591998
(2R,3R)-3-(benzylamino)-1,1,1-trifluoro-5-phenylpentan-2-ol (PubChem CID 10591998) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-5-phenylpentan-2-ol.
| Compound Name | (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-5-phenylpentan-2-ol |
|---|---|
| PubChem CID | 10591998 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R,3R)-3-(benzylamino)-1,1,1-trifluoro-5-phenylpentan-2-ol |
| SMILES | O[C@H]([C@@H](CCc1ccccc1)NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO/c19-18(20,21)17(23)16(12-11-14-7-3-1-4-8-14)22-13-15-9-5-2-6-10-15/h1-10,16-17,22-23H,11-13H2/t16-,17-/m1/s1 |
| InChIKey | WPWJCUVBCFRLEL-IAGOWNOFSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |