C12H16F3NO — CID 62881119
4-phenyl-2-(2,2,2-trifluoroethylamino)butan-1-ol (PubChem CID 62881119) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-phenyl-2-(2,2,2-trifluoroethylamino)butan-1-ol.
| Compound Name | 4-phenyl-2-(2,2,2-trifluoroethylamino)butan-1-ol |
|---|---|
| PubChem CID | 62881119 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-phenyl-2-(2,2,2-trifluoroethylamino)butan-1-ol |
| SMILES | OCC(CCc1ccccc1)NCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c13-12(14,15)9-16-11(8-17)7-6-10-4-2-1-3-5-10/h1-5,11,16-17H,6-9H2 |
| InChIKey | QORAQIZRRPLMHL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |