C11H13ClF3N — CID 121221476
N-benzyl-4-chloro-1,1,1-trifluorobutan-2-amine (PubChem CID 121221476) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is N-benzyl-4-chloro-1,1,1-trifluorobutan-2-amine.
| Compound Name | N-benzyl-4-chloro-1,1,1-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 121221476 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-benzyl-4-chloro-1,1,1-trifluorobutan-2-amine |
| SMILES | FC(F)(F)C(CCCl)NCc1ccccc1 |
| InChI | InChI=1S/C11H13ClF3N/c12-7-6-10(11(13,14)15)16-8-9-4-2-1-3-5-9/h1-5,10,16H,6-8H2 |
| InChIKey | OLLJVFRDCAGXKT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|