C16H26ClN — CID 106354049
1-chloro-N-[(4-ethylphenyl)methyl]-4,4-dimethylpentan-3-amine (PubChem CID 106354049) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is 1-chloro-N-[(4-ethylphenyl)methyl]-4,4-dimethylpentan-3-amine.
| Compound Name | 1-chloro-N-[(4-ethylphenyl)methyl]-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 106354049 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-chloro-N-[(4-ethylphenyl)methyl]-4,4-dimethylpentan-3-amine |
| SMILES | CCc1ccc(CNC(CCCl)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26ClN/c1-5-13-6-8-14(9-7-13)12-18-15(10-11-17)16(2,3)4/h6-9,15,18H,5,10-12H2,1-4H3 |
| InChIKey | HKPNDUJTISGEKS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|