C17H28ClN — CID 106354200
1-chloro-4,4-dimethyl-N-[(2,4,6-trimethylphenyl)methyl]pentan-3-amine (PubChem CID 106354200) has the molecular formula C17H28ClN and a molecular weight of 281.87 g/mol. Its IUPAC name is 1-chloro-4,4-dimethyl-N-[(2,4,6-trimethylphenyl)methyl]pentan-3-amine.
| Compound Name | 1-chloro-4,4-dimethyl-N-[(2,4,6-trimethylphenyl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 106354200 |
| Molecular Formula | C17H28ClN |
| Molecular Weight | 281.87 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-chloro-4,4-dimethyl-N-[(2,4,6-trimethylphenyl)methyl]pentan-3-amine |
| SMILES | Cc1cc(C)c(CNC(CCCl)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H28ClN/c1-12-9-13(2)15(14(3)10-12)11-19-16(7-8-18)17(4,5)6/h9-10,16,19H,7-8,11H2,1-6H3 |
| InChIKey | JMEMLBIRZSTRCQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.87 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|