C17H26ClNO — CID 106354005
1-chloro-4,4-dimethyl-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]pentan-3-amine (PubChem CID 106354005) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is 1-chloro-4,4-dimethyl-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]pentan-3-amine.
| Compound Name | 1-chloro-4,4-dimethyl-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 106354005 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-chloro-4,4-dimethyl-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]pentan-3-amine |
| SMILES | Cc1ccc2c(c1)CC(CNC(CCCl)C(C)(C)C)O2 |
| InChI | InChI=1S/C17H26ClNO/c1-12-5-6-15-13(9-12)10-14(20-15)11-19-16(7-8-18)17(2,3)4/h5-6,9,14,16,19H,7-8,10-11H2,1-4H3 |
| InChIKey | MCLNWNKGIGXJPT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|