C15H21ClFNO — CID 106353817
1-chloro-N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpentan-3-amine (PubChem CID 106353817) has the molecular formula C15H21ClFNO and a molecular weight of 285.79 g/mol. Its IUPAC name is 1-chloro-N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpentan-3-amine.
| Compound Name | 1-chloro-N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 106353817 |
| Molecular Formula | C15H21ClFNO |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-chloro-N-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-4-methylpentan-3-amine |
| SMILES | CC(C)C(CCCl)NCC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H21ClFNO/c1-10(2)14(5-6-16)18-9-13-8-11-7-12(17)3-4-15(11)19-13/h3-4,7,10,13-14,18H,5-6,8-9H2,1-2H3 |
| InChIKey | OEFJXBVRGDJHIV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|