C14H18ClFO — CID 66362279
2-[2-(chloromethyl)-3-methylbutyl]-5-fluoro-2,3-dihydro-1-benzofuran (PubChem CID 66362279) has the molecular formula C14H18ClFO and a molecular weight of 256.75 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-methylbutyl]-5-fluoro-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[2-(chloromethyl)-3-methylbutyl]-5-fluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 66362279 |
| Molecular Formula | C14H18ClFO |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[2-(chloromethyl)-3-methylbutyl]-5-fluoro-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)C(CCl)CC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C14H18ClFO/c1-9(2)11(8-15)7-13-6-10-5-12(16)3-4-14(10)17-13/h3-5,9,11,13H,6-8H2,1-2H3 |
| InChIKey | NEPBPXIGGRRFCS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|