C13H20BrClN2 — CID 106353967
N-[(5-bromo-2-pyridinyl)methyl]-1-chloro-4,4-dimethylpentan-3-amine (PubChem CID 106353967) has the molecular formula C13H20BrClN2 and a molecular weight of 319.67 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-1-chloro-4,4-dimethylpentan-3-amine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-1-chloro-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 106353967 |
| Molecular Formula | C13H20BrClN2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-1-chloro-4,4-dimethylpentan-3-amine |
| SMILES | CC(C)(C)C(CCCl)NCc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H20BrClN2/c1-13(2,3)12(6-7-15)17-9-11-5-4-10(14)8-16-11/h4-5,8,12,17H,6-7,9H2,1-3H3 |
| InChIKey | QZAWMGNLHFASMK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|