C12H17BrClN — CID 104813393
5-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]pyridine (PubChem CID 104813393) has the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. Its IUPAC name is 5-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]pyridine.
| Compound Name | 5-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]pyridine |
|---|---|
| PubChem CID | 104813393 |
| Molecular Formula | C12H17BrClN |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]pyridine |
| SMILES | CC(C)(C)C(CCl)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H17BrClN/c1-12(2,3)9(7-14)6-11-5-4-10(13)8-15-11/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | XGQKARXFLSBBNP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|