C14H23BrN2 — CID 104810480
2-[(5-bromo-2-pyridinyl)methyl]-N-tert-butylbutan-1-amine (PubChem CID 104810480) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)methyl]-N-tert-butylbutan-1-amine.
| Compound Name | 2-[(5-bromo-2-pyridinyl)methyl]-N-tert-butylbutan-1-amine |
|---|---|
| PubChem CID | 104810480 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)methyl]-N-tert-butylbutan-1-amine |
| SMILES | CCC(CNC(C)(C)C)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C14H23BrN2/c1-5-11(9-17-14(2,3)4)8-13-7-6-12(15)10-16-13/h6-7,10-11,17H,5,8-9H2,1-4H3 |
| InChIKey | ZPRLCCJDKPOVIA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |