C11H17BrN2 — CID 104810470
2-[(5-bromo-2-pyridinyl)methyl]-N-methylbutan-1-amine (PubChem CID 104810470) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)methyl]-N-methylbutan-1-amine.
| Compound Name | 2-[(5-bromo-2-pyridinyl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 104810470 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)methyl]-N-methylbutan-1-amine |
| SMILES | CCC(CNC)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H17BrN2/c1-3-9(7-13-2)6-11-5-4-10(12)8-14-11/h4-5,8-9,13H,3,6-7H2,1-2H3 |
| InChIKey | HZDXEOKGTXNLPR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |