C9H12BrClN2 — CID 104811160
N-[(5-bromo-2-pyridinyl)methyl]-2-chloropropan-1-amine (PubChem CID 104811160) has the molecular formula C9H12BrClN2 and a molecular weight of 263.57 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-2-chloropropan-1-amine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-2-chloropropan-1-amine |
|---|---|
| PubChem CID | 104811160 |
| Molecular Formula | C9H12BrClN2 |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-2-chloropropan-1-amine |
| SMILES | CC(Cl)CNCc1ccc(Br)cn1 |
| InChI | InChI=1S/C9H12BrClN2/c1-7(11)4-12-6-9-3-2-8(10)5-13-9/h2-3,5,7,12H,4,6H2,1H3 |
| InChIKey | SBJDECVRKXAWTQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|