C12H17BrN2 — CID 103735445
1-(5-bromo-2-pyridinyl)-N-[(1-ethylcyclopropyl)methyl]methanamine (PubChem CID 103735445) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-N-[(1-ethylcyclopropyl)methyl]methanamine.
| Compound Name | 1-(5-bromo-2-pyridinyl)-N-[(1-ethylcyclopropyl)methyl]methanamine |
|---|---|
| PubChem CID | 103735445 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-N-[(1-ethylcyclopropyl)methyl]methanamine |
| SMILES | CCC1(CNCc2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C12H17BrN2/c1-2-12(5-6-12)9-14-8-11-4-3-10(13)7-15-11/h3-4,7,14H,2,5-6,8-9H2,1H3 |
| InChIKey | UWUFDRNEXNDMLT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |