C11H17BrClNS — CID 115680308
1-(4-bromothiophen-2-yl)-N-[(1-ethylcyclopropyl)methyl]methanamine;hydrochloride (PubChem CID 115680308) has the molecular formula C11H17BrClNS and a molecular weight of 310.69 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-[(1-ethylcyclopropyl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-[(1-ethylcyclopropyl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 115680308 |
| Molecular Formula | C11H17BrClNS |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-[(1-ethylcyclopropyl)methyl]methanamine;hydrochloride |
| SMILES | CCC1(CNCc2cc(Br)cs2)CC1.Cl |
| InChI | InChI=1S/C11H16BrNS.ClH/c1-2-11(3-4-11)8-13-6-10-5-9(12)7-14-10;/h5,7,13H,2-4,6,8H2,1H3;1H |
| InChIKey | APKYTDJQHPDYKT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |