C9H12BrNS — CID 66025971
[1-[(4-bromothiophen-2-yl)methyl]cyclopropyl]methanamine (PubChem CID 66025971) has the molecular formula C9H12BrNS and a molecular weight of 246.17 g/mol. Its IUPAC name is [1-[(4-bromothiophen-2-yl)methyl]cyclopropyl]methanamine.
| Compound Name | [1-[(4-bromothiophen-2-yl)methyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 66025971 |
| Molecular Formula | C9H12BrNS |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | [1-[(4-bromothiophen-2-yl)methyl]cyclopropyl]methanamine |
| SMILES | NCC1(Cc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C9H12BrNS/c10-7-3-8(12-5-7)4-9(6-11)1-2-9/h3,5H,1-2,4,6,11H2 |
| InChIKey | GIXASBMPOFNAAP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |