C13H18BrN — CID 103735508
1-(3-bromophenyl)-N-[(1-ethylcyclopropyl)methyl]methanamine (PubChem CID 103735508) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[(1-ethylcyclopropyl)methyl]methanamine.
| Compound Name | 1-(3-bromophenyl)-N-[(1-ethylcyclopropyl)methyl]methanamine |
|---|---|
| PubChem CID | 103735508 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(3-bromophenyl)-N-[(1-ethylcyclopropyl)methyl]methanamine |
| SMILES | CCC1(CNCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C13H18BrN/c1-2-13(6-7-13)10-15-9-11-4-3-5-12(14)8-11/h3-5,8,15H,2,6-7,9-10H2,1H3 |
| InChIKey | PTDJRNVRGZYMGF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |