C13H17Br — CID 143267542
1-bromo-3-[(1-propylcyclopropyl)methyl]benzene (PubChem CID 143267542) has the molecular formula C13H17Br and a molecular weight of 253.18 g/mol. Its IUPAC name is 1-bromo-3-[(1-propylcyclopropyl)methyl]benzene.
| Compound Name | 1-bromo-3-[(1-propylcyclopropyl)methyl]benzene |
|---|---|
| PubChem CID | 143267542 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-bromo-3-[(1-propylcyclopropyl)methyl]benzene |
| SMILES | CCCC1(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C13H17Br/c1-2-6-13(7-8-13)10-11-4-3-5-12(14)9-11/h3-5,9H,2,6-8,10H2,1H3 |
| InChIKey | LPCQMOWMDMLXLS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |