C12H19BrN2O — CID 115626597
N-[(5-bromo-2-pyridinyl)methyl]-2-(2-methylpropoxy)ethanamine (PubChem CID 115626597) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl]-2-(2-methylpropoxy)ethanamine.
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl]-2-(2-methylpropoxy)ethanamine |
|---|---|
| PubChem CID | 115626597 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl]-2-(2-methylpropoxy)ethanamine |
| SMILES | CC(C)COCCNCc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H19BrN2O/c1-10(2)9-16-6-5-14-8-12-4-3-11(13)7-15-12/h3-4,7,10,14H,5-6,8-9H2,1-2H3 |
| InChIKey | ZLOSRSUBHIJAIR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|