C15H18BrN3O2 — CID 104796402
N-[[5-[(5-bromo-2-pyridinyl)methoxy]-2-pyridinyl]methyl]-2-methoxyethanamine (PubChem CID 104796402) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is N-[[5-[(5-bromo-2-pyridinyl)methoxy]-2-pyridinyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-[(5-bromo-2-pyridinyl)methoxy]-2-pyridinyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 104796402 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[[5-[(5-bromo-2-pyridinyl)methoxy]-2-pyridinyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(OCc2ccc(Br)cn2)cn1 |
| InChI | InChI=1S/C15H18BrN3O2/c1-20-7-6-17-9-13-4-5-15(10-19-13)21-11-14-3-2-12(16)8-18-14/h2-5,8,10,17H,6-7,9,11H2,1H3 |
| InChIKey | SUFHKIVEVBLJJQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|