C12H17Br2ClN2 — CID 106354418
3,5-dibromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridin-2-amine (PubChem CID 106354418) has the molecular formula C12H17Br2ClN2 and a molecular weight of 384.54 g/mol. Its IUPAC name is 3,5-dibromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 106354418 |
| Molecular Formula | C12H17Br2ClN2 |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 3,5-dibromo-N-(1-chloro-4,4-dimethylpentan-3-yl)pyridin-2-amine |
| SMILES | CC(C)(C)C(CCCl)Nc1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br2ClN2/c1-12(2,3)10(4-5-15)17-11-9(14)6-8(13)7-16-11/h6-7,10H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | ZLHKZXUJXHRIFG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|