C11H15Br2ClN2 — CID 107156387
3,5-dibromo-N-(2-chloro-4-methylpentyl)pyridin-2-amine (PubChem CID 107156387) has the molecular formula C11H15Br2ClN2 and a molecular weight of 370.52 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-chloro-4-methylpentyl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(2-chloro-4-methylpentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107156387 |
| Molecular Formula | C11H15Br2ClN2 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | 3,5-dibromo-N-(2-chloro-4-methylpentyl)pyridin-2-amine |
| SMILES | CC(C)CC(Cl)CNc1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2ClN2/c1-7(2)3-9(14)6-16-11-10(13)4-8(12)5-15-11/h4-5,7,9H,3,6H2,1-2H3,(H,15,16) |
| InChIKey | NHIQWSZUFPDONN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|