C11H16Br2N2 — CID 104828759
3,5-dibromo-N-(3,3-dimethylbutan-2-yl)pyridin-2-amine (PubChem CID 104828759) has the molecular formula C11H16Br2N2 and a molecular weight of 336.07 g/mol. Its IUPAC name is 3,5-dibromo-N-(3,3-dimethylbutan-2-yl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(3,3-dimethylbutan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 104828759 |
| Molecular Formula | C11H16Br2N2 |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 3,5-dibromo-N-(3,3-dimethylbutan-2-yl)pyridin-2-amine |
| SMILES | CC(Nc1ncc(Br)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C11H16Br2N2/c1-7(11(2,3)4)15-10-9(13)5-8(12)6-14-10/h5-7H,1-4H3,(H,14,15) |
| InChIKey | IGTLSVWOPBPLCN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |