C11H17ClIN3 — CID 106354463
N-(1-chloro-4,4-dimethylpentan-3-yl)-5-iodopyrimidin-2-amine (PubChem CID 106354463) has the molecular formula C11H17ClIN3 and a molecular weight of 353.64 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-5-iodopyrimidin-2-amine.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 106354463 |
| Molecular Formula | C11H17ClIN3 |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-5-iodopyrimidin-2-amine |
| SMILES | CC(C)(C)C(CCCl)Nc1ncc(I)cn1 |
| InChI | InChI=1S/C11H17ClIN3/c1-11(2,3)9(4-5-12)16-10-14-6-8(13)7-15-10/h6-7,9H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | GCASFHOOZFTJNG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|